C15H15N3O3S — CID 176561332
N-(2-hydroxyethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide (PubChem CID 176561332) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-(2-hydroxyethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 176561332 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-(2-hydroxyethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCO)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O3S/c19-9-8-16-22(20,21)12-6-7-13-14(10-12)18-15(17-13)11-4-2-1-3-5-11/h1-7,10,16,19H,8-9H2,(H,17,18) |
| InChIKey | WOZCEGCTFQQASJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |