C18H13ClN4O2S — CID 25039590
N-(2-chloro-3-pyridinyl)-2-phenyl-3H-benzimidazole-5-sulfonamide (PubChem CID 25039590) has the molecular formula C18H13ClN4O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-phenyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 25039590 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cccnc1Cl)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C18H13ClN4O2S/c19-17-15(7-4-10-20-17)23-26(24,25)13-8-9-14-16(11-13)22-18(21-14)12-5-2-1-3-6-12/h1-11,23H,(H,21,22) |
| InChIKey | KUCKWOCTZLJZKI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|