C13H10N2O5S2 — CID 137408588
sulfino 2-phenyl-3H-benzimidazole-5-sulfonate (PubChem CID 137408588) has the molecular formula C13H10N2O5S2 and a molecular weight of 338.37 g/mol. Its IUPAC name is sulfino 2-phenyl-3H-benzimidazole-5-sulfonate.
| Compound Name | sulfino 2-phenyl-3H-benzimidazole-5-sulfonate |
|---|---|
| PubChem CID | 137408588 |
| Molecular Formula | C13H10N2O5S2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | sulfino 2-phenyl-3H-benzimidazole-5-sulfonate |
| SMILES | O=S(O)OS(=O)(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C13H10N2O5S2/c16-21(17)20-22(18,19)10-6-7-11-12(8-10)15-13(14-11)9-4-2-1-3-5-9/h1-8H,(H,14,15)(H,16,17) |
| InChIKey | SLAGXMLQHQESAV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|