C19H17N5O2S — CID 3728615
N,N-bis(2-cyanoethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide (PubChem CID 3728615) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 3728615 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-phenyl-3H-benzimidazole-5-sulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C19H17N5O2S/c20-10-4-12-24(13-5-11-21)27(25,26)16-8-9-17-18(14-16)23-19(22-17)15-6-2-1-3-7-15/h1-3,6-9,14H,4-5,12-13H2,(H,22,23) |
| InChIKey | GBNXYIPNJXIBPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |