C19H16N2O4S — CID 87359736
cyclohexa-2,4-dien-1-one;2-phenyl-3H-benzimidazole-5-sulfonic acid (PubChem CID 87359736) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-one;2-phenyl-3H-benzimidazole-5-sulfonic acid.
| Compound Name | cyclohexa-2,4-dien-1-one;2-phenyl-3H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 87359736 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | cyclohexa-2,4-dien-1-one;2-phenyl-3H-benzimidazole-5-sulfonic acid |
| SMILES | O=C1C=CC=CC1.O=S(=O)(O)c1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C13H10N2O3S.C6H6O/c16-19(17,18)10-6-7-11-12(8-10)15-13(14-11)9-4-2-1-3-5-9;7-6-4-2-1-3-5-6/h1-8H,(H,14,15)(H,16,17,18);1-4H,5H2 |
| InChIKey | FZRVZNSMOQJSCN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|