C22H19ClN4O3S — CID 46273821
N-(4-chlorophenyl)-3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]propanamide (PubChem CID 46273821) has the molecular formula C22H19ClN4O3S and a molecular weight of 454.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 46273821 |
| Molecular Formula | C22H19ClN4O3S |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN4O3S/c23-16-6-8-17(9-7-16)25-21(28)12-13-24-31(29,30)18-10-11-19-20(14-18)27-22(26-19)15-4-2-1-3-5-15/h1-11,14,24H,12-13H2,(H,25,28)(H,26,27) |
| InChIKey | PAVALXGRYFLTLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |