C18H17N3O4S2 — CID 142685326
[2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl] 2-amino-4-methylbenzenesulfonate (PubChem CID 142685326) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is [2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl] 2-amino-4-methylbenzenesulfonate.
| Compound Name | [2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl] 2-amino-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142685326 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [2-(cyclopropanecarbonylamino)-1,3-benzothiazol-6-yl] 2-amino-4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc3nc(NC(=O)C4CC4)sc3c2)c(N)c1 |
| InChI | InChI=1S/C18H17N3O4S2/c1-10-2-7-16(13(19)8-10)27(23,24)25-12-5-6-14-15(9-12)26-18(20-14)21-17(22)11-3-4-11/h2,5-9,11H,3-4,19H2,1H3,(H,20,21,22) |
| InChIKey | CMLRXAJPIKOSDY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|