C22H19N5O2 — CID 156516653
methyl 4-[2-(1H-indol-3-yl)ethylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 156516653) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is methyl 4-[2-(1H-indol-3-yl)ethylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 4-[2-(1H-indol-3-yl)ethylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 156516653 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 4-[2-(1H-indol-3-yl)ethylamino]-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1ncnc(NCCc3c[nH]c4ccccc34)c12 |
| InChI | InChI=1S/C22H19N5O2/c1-29-22(28)13-6-7-16-18(10-13)27-21-19(16)20(25-12-26-21)23-9-8-14-11-24-17-5-3-2-4-15(14)17/h2-7,10-12,24H,8-9H2,1H3,(H2,23,25,26,27) |
| InChIKey | HHJQAJCUSHGMFN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |