C23H22N4O2 — CID 59555814
methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]pyridine-2-carboxylate (PubChem CID 59555814) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59555814 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(Nc2ccc(NCCc3c[nH]c4ccccc34)cc2)ccn1 |
| InChI | InChI=1S/C23H22N4O2/c1-29-23(28)22-14-19(11-13-25-22)27-18-8-6-17(7-9-18)24-12-10-16-15-26-21-5-3-2-4-20(16)21/h2-9,11,13-15,24,26H,10,12H2,1H3,(H,25,27) |
| InChIKey | SSVYEOFVDSPYFV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|