C26H26N4O3 — CID 143202815
methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-6-(1-methoxyethenyl)pyridine-2-carboxylate (PubChem CID 143202815) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-6-(1-methoxyethenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-6-(1-methoxyethenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143202815 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | methyl 4-[4-[2-(1H-indol-3-yl)ethylamino]anilino]-6-(1-methoxyethenyl)pyridine-2-carboxylate |
| SMILES | C=C(OC)c1cc(Nc2ccc(NCCc3c[nH]c4ccccc34)cc2)cc(C(=O)OC)n1 |
| InChI | InChI=1S/C26H26N4O3/c1-17(32-2)24-14-21(15-25(30-24)26(31)33-3)29-20-10-8-19(9-11-20)27-13-12-18-16-28-23-7-5-4-6-22(18)23/h4-11,14-16,27-28H,1,12-13H2,2-3H3,(H,29,30) |
| InChIKey | KRERVMCGHOLIDK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|