C23H22N4O2 — CID 109215319
N-[2-(1H-indol-3-yl)ethyl]-4-(3-methoxyanilino)pyridine-2-carboxamide (PubChem CID 109215319) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-4-(3-methoxyanilino)pyridine-2-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-4-(3-methoxyanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109215319 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-4-(3-methoxyanilino)pyridine-2-carboxamide |
| SMILES | COc1cccc(Nc2ccnc(C(=O)NCCc3c[nH]c4ccccc34)c2)c1 |
| InChI | InChI=1S/C23H22N4O2/c1-29-19-6-4-5-17(13-19)27-18-10-12-24-22(14-18)23(28)25-11-9-16-15-26-21-8-3-2-7-20(16)21/h2-8,10,12-15,26H,9,11H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | CMRYIINRJCJIOP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |