C22H26N4O2 — CID 109088487
2-N-[2-(1H-indol-3-yl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide (PubChem CID 109088487) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088487 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-pentylpyridine-2,4-dicarboxamide |
| SMILES | CCCCCNC(=O)c1ccnc(C(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-2-3-6-11-24-21(27)16-9-12-23-20(14-16)22(28)25-13-10-17-15-26-19-8-5-4-7-18(17)19/h4-5,7-9,12,14-15,26H,2-3,6,10-11,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | NHUILXPWQFICEC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|