C24H22N4O2 — CID 109088496
2-N-[2-(1H-indol-3-yl)ethyl]-4-N-methyl-4-N-phenylpyridine-2,4-dicarboxamide (PubChem CID 109088496) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-methyl-4-N-phenylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-methyl-4-N-phenylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088496 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-N-[2-(1H-indol-3-yl)ethyl]-4-N-methyl-4-N-phenylpyridine-2,4-dicarboxamide |
| SMILES | CN(C(=O)c1ccnc(C(=O)NCCc2c[nH]c3ccccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O2/c1-28(19-7-3-2-4-8-19)24(30)17-11-13-25-22(15-17)23(29)26-14-12-18-16-27-21-10-6-5-9-20(18)21/h2-11,13,15-16,27H,12,14H2,1H3,(H,26,29) |
| InChIKey | IGVYNWHUYYVKDA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |