C22H26N4O — CID 109166332
2-(cyclohexylamino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-4-carboxamide (PubChem CID 109166332) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166332 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(cyclohexylamino)-N-[2-(1H-indol-3-yl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1ccnc(NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H26N4O/c27-22(24-13-11-17-15-25-20-9-5-4-8-19(17)20)16-10-12-23-21(14-16)26-18-6-2-1-3-7-18/h4-5,8-10,12,14-15,18,25H,1-3,6-7,11,13H2,(H,23,26)(H,24,27) |
| InChIKey | VHNQZHRIWZQWKY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |