C22H27N5O — CID 109285624
5-(cycloheptylamino)-N-[2-(1H-indol-3-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 109285624) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-(cycloheptylamino)-N-[2-(1H-indol-3-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(cycloheptylamino)-N-[2-(1H-indol-3-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109285624 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 5-(cycloheptylamino)-N-[2-(1H-indol-3-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cnc(NC2CCCCCC2)cn1 |
| InChI | InChI=1S/C22H27N5O/c28-22(23-12-11-16-13-24-19-10-6-5-9-18(16)19)20-14-26-21(15-25-20)27-17-7-3-1-2-4-8-17/h5-6,9-10,13-15,17,24H,1-4,7-8,11-12H2,(H,23,28)(H,26,27) |
| InChIKey | LTDORFPBOQYFRN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |