C23H23N5O — CID 109280515
5-[2-(1H-indol-3-yl)ethylamino]-N-[(4-methylphenyl)methyl]pyrazine-2-carboxamide (PubChem CID 109280515) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)ethylamino]-N-[(4-methylphenyl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-[2-(1H-indol-3-yl)ethylamino]-N-[(4-methylphenyl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109280515 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)ethylamino]-N-[(4-methylphenyl)methyl]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cnc(NCCc3c[nH]c4ccccc34)cn2)cc1 |
| InChI | InChI=1S/C23H23N5O/c1-16-6-8-17(9-7-16)12-28-23(29)21-14-27-22(15-26-21)24-11-10-18-13-25-20-5-3-2-4-19(18)20/h2-9,13-15,25H,10-12H2,1H3,(H,24,27)(H,28,29) |
| InChIKey | SBMHEAOTSNVKCL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |