C22H21N5O — CID 109303774
N-benzyl-2-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109303774) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-benzyl-2-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-benzyl-2-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109303774 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-benzyl-2-[2-(1H-indol-3-yl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccnc(NCCc2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C22H21N5O/c28-21(26-14-16-6-2-1-3-7-16)20-11-13-24-22(27-20)23-12-10-17-15-25-19-9-5-4-8-18(17)19/h1-9,11,13,15,25H,10,12,14H2,(H,26,28)(H,23,24,27) |
| InChIKey | KZXCKJCKUPTGDW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |