C21H26N6O — CID 109302555
(4-ethylpiperazin-1-yl)-[2-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]methanone (PubChem CID 109302555) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[2-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[2-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 109302555 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[2-[2-(1H-indol-3-yl)ethylamino]pyrimidin-4-yl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccnc(NCCc3c[nH]c4ccccc34)n2)CC1 |
| InChI | InChI=1S/C21H26N6O/c1-2-26-11-13-27(14-12-26)20(28)19-8-10-23-21(25-19)22-9-7-16-15-24-18-6-4-3-5-17(16)18/h3-6,8,10,15,24H,2,7,9,11-14H2,1H3,(H,22,23,25) |
| InChIKey | FRBRITIGNKYPQM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |