C21H26N4O — CID 109237687
5-[2-(1H-indol-3-yl)ethylamino]-N-pentylpyridine-3-carboxamide (PubChem CID 109237687) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 5-[2-(1H-indol-3-yl)ethylamino]-N-pentylpyridine-3-carboxamide.
| Compound Name | 5-[2-(1H-indol-3-yl)ethylamino]-N-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237687 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 5-[2-(1H-indol-3-yl)ethylamino]-N-pentylpyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cncc(NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C21H26N4O/c1-2-3-6-10-24-21(26)17-12-18(15-22-13-17)23-11-9-16-14-25-20-8-5-4-7-19(16)20/h4-5,7-8,12-15,23,25H,2-3,6,9-11H2,1H3,(H,24,26) |
| InChIKey | RCQVCWVFLIQACJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|