C20H24N4O2 — CID 109228227
N-[2-(1H-indol-3-yl)ethyl]-5-(3-methoxypropylamino)pyridine-3-carboxamide (PubChem CID 109228227) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-5-(3-methoxypropylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-5-(3-methoxypropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228227 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-5-(3-methoxypropylamino)pyridine-3-carboxamide |
| SMILES | COCCCNc1cncc(C(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C20H24N4O2/c1-26-10-4-8-22-17-11-16(12-21-14-17)20(25)23-9-7-15-13-24-19-6-3-2-5-18(15)19/h2-3,5-6,11-14,22,24H,4,7-10H2,1H3,(H,23,25) |
| InChIKey | BDFNUEKPTHHTSH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|