C15H17N5O — CID 82455159
4-N-[2-(1H-indol-3-yl)ethyl]-6-methoxypyrimidine-4,5-diamine (PubChem CID 82455159) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is 4-N-[2-(1H-indol-3-yl)ethyl]-6-methoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-methoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455159 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-N-[2-(1H-indol-3-yl)ethyl]-6-methoxypyrimidine-4,5-diamine |
| SMILES | COc1ncnc(NCCc2c[nH]c3ccccc23)c1N |
| InChI | InChI=1S/C15H17N5O/c1-21-15-13(16)14(19-9-20-15)17-7-6-10-8-18-12-5-3-2-4-11(10)12/h2-5,8-9,18H,6-7,16H2,1H3,(H,17,19,20) |
| InChIKey | JKVCDSCJJKAZBL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |