C27H33N5O3 — CID 145041706
methyl 1-[3-[ethyl(2-methoxyethyl)amino]propylamino]-3-(pyridin-3-ylmethyl)-5H-pyrido[4,3-b]indole-7-carboxylate (PubChem CID 145041706) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl 1-[3-[ethyl(2-methoxyethyl)amino]propylamino]-3-(pyridin-3-ylmethyl)-5H-pyrido[4,3-b]indole-7-carboxylate.
| Compound Name | methyl 1-[3-[ethyl(2-methoxyethyl)amino]propylamino]-3-(pyridin-3-ylmethyl)-5H-pyrido[4,3-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 145041706 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | methyl 1-[3-[ethyl(2-methoxyethyl)amino]propylamino]-3-(pyridin-3-ylmethyl)-5H-pyrido[4,3-b]indole-7-carboxylate |
| SMILES | CCN(CCCNc1nc(Cc2cccnc2)cc2[nH]c3cc(C(=O)OC)ccc3c12)CCOC |
| InChI | InChI=1S/C27H33N5O3/c1-4-32(13-14-34-2)12-6-11-29-26-25-22-9-8-20(27(33)35-3)16-23(22)31-24(25)17-21(30-26)15-19-7-5-10-28-18-19/h5,7-10,16-18,31H,4,6,11-15H2,1-3H3,(H,29,30) |
| InChIKey | FCSIWFFWANGMNL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|