C17H20N2O3 — CID 11623587
methyl 4-[[2-hydroxyethyl(pyridin-3-ylmethyl)amino]methyl]benzoate (PubChem CID 11623587) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 4-[[2-hydroxyethyl(pyridin-3-ylmethyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[2-hydroxyethyl(pyridin-3-ylmethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 11623587 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | methyl 4-[[2-hydroxyethyl(pyridin-3-ylmethyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(CCO)Cc2cccnc2)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-22-17(21)16-6-4-14(5-7-16)12-19(9-10-20)13-15-3-2-8-18-11-15/h2-8,11,20H,9-10,12-13H2,1H3 |
| InChIKey | GVWLWTIUJRRGIF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |