C20H25N3O2S — CID 139608880
methyl 4-[[[(2S)-2-aminopentanethioyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate (PubChem CID 139608880) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is methyl 4-[[[(2S)-2-aminopentanethioyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(2S)-2-aminopentanethioyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 139608880 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl 4-[[[(2S)-2-aminopentanethioyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate |
| SMILES | CCC[C@H](N)C(=S)N(Cc1ccc(C(=O)OC)cc1)Cc1cccnc1 |
| InChI | InChI=1S/C20H25N3O2S/c1-3-5-18(21)19(26)23(14-16-6-4-11-22-12-16)13-15-7-9-17(10-8-15)20(24)25-2/h4,6-12,18H,3,5,13-14,21H2,1-2H3/t18-/m0/s1 |
| InChIKey | SCSGUQLKSHYYQX-SFHVURJKSA-N |
| XLogP | 3.33 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|