C23H23N3O3 — CID 139608966
methyl 4-[[[(2S)-2-amino-2-phenylacetyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate (PubChem CID 139608966) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is methyl 4-[[[(2S)-2-amino-2-phenylacetyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(2S)-2-amino-2-phenylacetyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 139608966 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 4-[[[(2S)-2-amino-2-phenylacetyl]-(pyridin-3-ylmethyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(Cc2cccnc2)C(=O)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O3/c1-29-23(28)20-11-9-17(10-12-20)15-26(16-18-6-5-13-25-14-18)22(27)21(24)19-7-3-2-4-8-19/h2-14,21H,15-16,24H2,1H3/t21-/m0/s1 |
| InChIKey | GICQEMRGQJGDLH-NRFANRHFSA-N |
| XLogP | 3.10 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |