C16H21N5O — CID 3799067
N-(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 3799067) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is N-(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 3799067 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-(8-methoxy-5H-pyrimido[5,4-b]indol-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc2[nH]c3c(NCCCN(C)C)ncnc3c2c1 |
| InChI | InChI=1S/C16H21N5O/c1-21(2)8-4-7-17-16-15-14(18-10-19-16)12-9-11(22-3)5-6-13(12)20-15/h5-6,9-10,20H,4,7-8H2,1-3H3,(H,17,18,19) |
| InChIKey | LTNSLRIMMBKKQP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|