C15H18N4 — CID 2018302
N-pentyl-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 2018302) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-pentyl-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-pentyl-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 2018302 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-pentyl-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | CCCCCNc1ncnc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C15H18N4/c1-2-3-6-9-16-15-14-13(17-10-18-15)11-7-4-5-8-12(11)19-14/h4-5,7-8,10,19H,2-3,6,9H2,1H3,(H,16,17,18) |
| InChIKey | MOXITAURSAQRKB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|