C17H13ClN4 — CID 944708
N-[(4-chlorophenyl)methyl]-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 944708) has the molecular formula C17H13ClN4 and a molecular weight of 308.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[(4-chlorophenyl)methyl]-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 944708 |
| Molecular Formula | C17H13ClN4 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | Clc1ccc(CNc2ncnc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C17H13ClN4/c18-12-7-5-11(6-8-12)9-19-17-16-15(20-10-21-17)13-3-1-2-4-14(13)22-16/h1-8,10,22H,9H2,(H,19,20,21) |
| InChIKey | QZOKEHLSQPJEOT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |