C18H14ClN3 — CID 56683447
N-[(3-chlorophenyl)methyl]-9H-pyrido[3,4-b]indol-1-amine (PubChem CID 56683447) has the molecular formula C18H14ClN3 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-9H-pyrido[3,4-b]indol-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-9H-pyrido[3,4-b]indol-1-amine |
|---|---|
| PubChem CID | 56683447 |
| Molecular Formula | C18H14ClN3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-9H-pyrido[3,4-b]indol-1-amine |
| SMILES | Clc1cccc(CNc2nccc3c2[nH]c2ccccc23)c1 |
| InChI | InChI=1S/C18H14ClN3/c19-13-5-3-4-12(10-13)11-21-18-17-15(8-9-20-18)14-6-1-2-7-16(14)22-17/h1-10,22H,11H2,(H,20,21) |
| InChIKey | MXIAYYMQZFSLAW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |