C20H14ClN5O — CID 170683426
8-[(3-chlorophenyl)methylamino]-5,9,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12-heptaen-15-one (PubChem CID 170683426) has the molecular formula C20H14ClN5O and a molecular weight of 375.82 g/mol. Its IUPAC name is 8-[(3-chlorophenyl)methylamino]-5,9,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12-heptaen-15-one.
| Compound Name | 8-[(3-chlorophenyl)methylamino]-5,9,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 170683426 |
| Molecular Formula | C20H14ClN5O |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 8-[(3-chlorophenyl)methylamino]-5,9,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12-heptaen-15-one |
| SMILES | O=c1[nH]ccc2c1[nH]c1c3ccncc3c(NCc3cccc(Cl)c3)nc21 |
| InChI | InChI=1S/C20H14ClN5O/c21-12-3-1-2-11(8-12)9-24-19-15-10-22-6-4-13(15)16-17(26-19)14-5-7-23-20(27)18(14)25-16/h1-8,10,25H,9H2,(H,23,27)(H,24,26) |
| InChIKey | FRSFMEXGOCCENJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |