C11H9BrClN3 — CID 66341926
5-bromo-N-[(3-chlorophenyl)methyl]pyrimidin-4-amine (PubChem CID 66341926) has the molecular formula C11H9BrClN3 and a molecular weight of 298.57 g/mol. Its IUPAC name is 5-bromo-N-[(3-chlorophenyl)methyl]pyrimidin-4-amine.
| Compound Name | 5-bromo-N-[(3-chlorophenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66341926 |
| Molecular Formula | C11H9BrClN3 |
| Molecular Weight | 298.57 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 5-bromo-N-[(3-chlorophenyl)methyl]pyrimidin-4-amine |
| SMILES | Clc1cccc(CNc2ncncc2Br)c1 |
| InChI | InChI=1S/C11H9BrClN3/c12-10-6-14-7-16-11(10)15-5-8-2-1-3-9(13)4-8/h1-4,6-7H,5H2,(H,14,15,16) |
| InChIKey | TYUKVTQJDNTXCM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |