C13H12BrClN2O — CID 114836485
[3-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]phenyl]methanol (PubChem CID 114836485) has the molecular formula C13H12BrClN2O and a molecular weight of 327.61 g/mol. Its IUPAC name is [3-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]phenyl]methanol.
| Compound Name | [3-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]phenyl]methanol |
|---|---|
| PubChem CID | 114836485 |
| Molecular Formula | C13H12BrClN2O |
| Molecular Weight | 327.61 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | [3-[[(3-bromo-5-chloro-2-pyridinyl)amino]methyl]phenyl]methanol |
| SMILES | OCc1cccc(CNc2ncc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C13H12BrClN2O/c14-12-5-11(15)7-17-13(12)16-6-9-2-1-3-10(4-9)8-18/h1-5,7,18H,6,8H2,(H,16,17) |
| InChIKey | PIVINYACIPLDGR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |