C19H15N5O — CID 123653745
4-[(3-pyridin-3-ylphenyl)methylamino]-1H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 123653745) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[(3-pyridin-3-ylphenyl)methylamino]-1H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-[(3-pyridin-3-ylphenyl)methylamino]-1H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123653745 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-[(3-pyridin-3-ylphenyl)methylamino]-1H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(NCc2cccc(-c3cccnc3)c2)c2cccnc2[nH]1 |
| InChI | InChI=1S/C19H15N5O/c25-19-23-17-16(7-3-9-21-17)18(24-19)22-11-13-4-1-5-14(10-13)15-6-2-8-20-12-15/h1-10,12H,11H2,(H2,21,22,23,24,25) |
| InChIKey | CWRBKFADQVWYNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |