C21H22N4O — CID 100696687
3-morpholin-4-yl-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine (PubChem CID 100696687) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine.
| Compound Name | 3-morpholin-4-yl-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 100696687 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-morpholin-4-yl-N-[(3-pyridin-3-ylphenyl)methyl]pyridin-2-amine |
| SMILES | c1cncc(-c2cccc(CNc3ncccc3N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C21H22N4O/c1-4-17(14-18(5-1)19-6-2-8-22-16-19)15-24-21-20(7-3-9-23-21)25-10-12-26-13-11-25/h1-9,14,16H,10-13,15H2,(H,23,24) |
| InChIKey | NXWOJFQMGKAHEF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |