C27H22N4O — CID 71181024
N-benzyl-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71181024) has the molecular formula C27H22N4O and a molecular weight of 418.50 g/mol. Its IUPAC name is N-benzyl-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-benzyl-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71181024 |
| Molecular Formula | C27H22N4O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-benzyl-6-(3-methoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1cccc(-c2ccc3nc(-c4cccnc4)nc(NCc4ccccc4)c3c2)c1 |
| InChI | InChI=1S/C27H22N4O/c1-32-23-11-5-9-20(15-23)21-12-13-25-24(16-21)27(29-17-19-7-3-2-4-8-19)31-26(30-25)22-10-6-14-28-18-22/h2-16,18H,17H2,1H3,(H,29,30,31) |
| InChIKey | CTMYTHYHQPBXBJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |