C20H14Cl2N4O — CID 71274367
N-(2,6-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71274367) has the molecular formula C20H14Cl2N4O and a molecular weight of 397.27 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-(2,6-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71274367 |
| Molecular Formula | C20H14Cl2N4O |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(2,6-dichlorophenyl)-6-methoxy-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3c(Cl)cccc3Cl)c2c1 |
| InChI | InChI=1S/C20H14Cl2N4O/c1-27-13-7-8-17-14(10-13)20(25-18-15(21)5-2-6-16(18)22)26-19(24-17)12-4-3-9-23-11-12/h2-11H,1H3,(H,24,25,26) |
| InChIKey | UBUKUOYJSHSBOJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |