C23H19N5O — CID 71181123
6-methoxy-N-(1-methylindol-2-yl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71181123) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is 6-methoxy-N-(1-methylindol-2-yl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 6-methoxy-N-(1-methylindol-2-yl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71181123 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 6-methoxy-N-(1-methylindol-2-yl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3cc4ccccc4n3C)c2c1 |
| InChI | InChI=1S/C23H19N5O/c1-28-20-8-4-3-6-15(20)12-21(28)26-23-18-13-17(29-2)9-10-19(18)25-22(27-23)16-7-5-11-24-14-16/h3-14H,1-2H3,(H,25,26,27) |
| InChIKey | KIVGSEIIDDLHPH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |