C48H44N8O2 — CID 141404533
6-(3-methoxyphenyl)-2-pyridin-3-yl-4-pyrrolidin-1-ylquinazoline (PubChem CID 141404533) has the molecular formula C48H44N8O2 and a molecular weight of 764.93 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-pyridin-3-yl-4-pyrrolidin-1-ylquinazoline.
| Compound Name | 6-(3-methoxyphenyl)-2-pyridin-3-yl-4-pyrrolidin-1-ylquinazoline |
|---|---|
| PubChem CID | 141404533 |
| Molecular Formula | C48H44N8O2 |
| Molecular Weight | 764.93 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-pyridin-3-yl-4-pyrrolidin-1-ylquinazoline |
| SMILES | COc1cccc(-c2ccc3nc(-c4cccnc4)nc(N4CCCC4)c3c2)c1.COc1cccc(-c2ccc3nc(-c4cccnc4)nc(N4CCCC4)c3c2)c1 |
| InChI | InChI=1S/2C24H22N4O/c2*1-29-20-8-4-6-17(14-20)18-9-10-22-21(15-18)24(28-12-2-3-13-28)27-23(26-22)19-7-5-11-25-16-19/h2*4-11,14-16H,2-3,12-13H2,1H3 |
| InChIKey | ZGHQOAXJRUOLRX-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 102.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.93 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |