C24H23N5O — CID 71180671
1-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-N,N-dimethyl-2,3-dihydroindol-5-amine (PubChem CID 71180671) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-N,N-dimethyl-2,3-dihydroindol-5-amine.
| Compound Name | 1-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-N,N-dimethyl-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 71180671 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-N,N-dimethyl-2,3-dihydroindol-5-amine |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(N3CCc4cc(N(C)C)ccc43)c2c1 |
| InChI | InChI=1S/C24H23N5O/c1-28(2)18-6-9-22-16(13-18)10-12-29(22)24-20-14-19(30-3)7-8-21(20)26-23(27-24)17-5-4-11-25-15-17/h4-9,11,13-15H,10,12H2,1-3H3 |
| InChIKey | NIPFDQDNABAQNA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|