C24H25N5O2 — CID 144500701
formamide;6-(3-methoxyphenyl)-N-propyl-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 144500701) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is formamide;6-(3-methoxyphenyl)-N-propyl-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | formamide;6-(3-methoxyphenyl)-N-propyl-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 144500701 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | formamide;6-(3-methoxyphenyl)-N-propyl-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CCCNc1nc(-c2cccnc2)nc2ccc(-c3cccc(OC)c3)cc12.NC=O |
| InChI | InChI=1S/C23H22N4O.CH3NO/c1-3-11-25-23-20-14-17(16-6-4-8-19(13-16)28-2)9-10-21(20)26-22(27-23)18-7-5-12-24-15-18;2-1-3/h4-10,12-15H,3,11H2,1-2H3,(H,25,26,27);1H,(H2,2,3) |
| InChIKey | LQHKXCJNOHMBDV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|