C23H22N4O — CID 71179891
N-methyl-6-(4-propoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 71179891) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-methyl-6-(4-propoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-methyl-6-(4-propoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71179891 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-methyl-6-(4-propoxyphenyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CCCOc1ccc(-c2ccc3nc(-c4cccnc4)nc(NC)c3c2)cc1 |
| InChI | InChI=1S/C23H22N4O/c1-3-13-28-19-9-6-16(7-10-19)17-8-11-21-20(14-17)23(24-2)27-22(26-21)18-5-4-12-25-15-18/h4-12,14-15H,3,13H2,1-2H3,(H,24,26,27) |
| InChIKey | VTBJZAWKQSJOMG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |