C20H14FIN4 — CID 122494265
6-(3-fluoro-4-iodophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 122494265) has the molecular formula C20H14FIN4 and a molecular weight of 456.26 g/mol. Its IUPAC name is 6-(3-fluoro-4-iodophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | 6-(3-fluoro-4-iodophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 122494265 |
| Molecular Formula | C20H14FIN4 |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 6-(3-fluoro-4-iodophenyl)-N-methyl-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2ccc(-c3ccc(I)c(F)c3)cc12 |
| InChI | InChI=1S/C20H14FIN4/c1-23-20-15-9-12(13-4-6-17(22)16(21)10-13)5-7-18(15)25-19(26-20)14-3-2-8-24-11-14/h2-11H,1H3,(H,23,25,26) |
| InChIKey | ILQHPJGWSVRBLB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|