C20H15N5O2 — CID 89347896
N-methyl-6-(3-nitrophenyl)-2-pyridin-3-ylquinazolin-4-amine (PubChem CID 89347896) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-methyl-6-(3-nitrophenyl)-2-pyridin-3-ylquinazolin-4-amine.
| Compound Name | N-methyl-6-(3-nitrophenyl)-2-pyridin-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 89347896 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-methyl-6-(3-nitrophenyl)-2-pyridin-3-ylquinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2ccc(-c3cccc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C20H15N5O2/c1-21-20-17-11-14(13-4-2-6-16(10-13)25(26)27)7-8-18(17)23-19(24-20)15-5-3-9-22-12-15/h2-12H,1H3,(H,21,23,24) |
| InChIKey | RZABXSNWKUHENM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|