C25H23F3N4O — CID 146736740
N-methyl-2-pyridin-3-yl-6-[3-(5,5,5-trifluoropentoxy)phenyl]quinazolin-4-amine (PubChem CID 146736740) has the molecular formula C25H23F3N4O and a molecular weight of 452.48 g/mol. Its IUPAC name is N-methyl-2-pyridin-3-yl-6-[3-(5,5,5-trifluoropentoxy)phenyl]quinazolin-4-amine.
| Compound Name | N-methyl-2-pyridin-3-yl-6-[3-(5,5,5-trifluoropentoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146736740 |
| Molecular Formula | C25H23F3N4O |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-methyl-2-pyridin-3-yl-6-[3-(5,5,5-trifluoropentoxy)phenyl]quinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2ccc(-c3cccc(OCCCCC(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C25H23F3N4O/c1-29-24-21-15-18(9-10-22(21)31-23(32-24)19-7-5-12-30-16-19)17-6-4-8-20(14-17)33-13-3-2-11-25(26,27)28/h4-10,12,14-16H,2-3,11,13H2,1H3,(H,29,31,32) |
| InChIKey | RJHQSXIPOZQPFM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|