C26H23N5O — CID 71179868
N-methyl-2-pyridin-3-yl-6-[3-(2-pyrrol-1-ylethoxy)phenyl]quinazolin-4-amine (PubChem CID 71179868) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is N-methyl-2-pyridin-3-yl-6-[3-(2-pyrrol-1-ylethoxy)phenyl]quinazolin-4-amine.
| Compound Name | N-methyl-2-pyridin-3-yl-6-[3-(2-pyrrol-1-ylethoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 71179868 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-methyl-2-pyridin-3-yl-6-[3-(2-pyrrol-1-ylethoxy)phenyl]quinazolin-4-amine |
| SMILES | CNc1nc(-c2cccnc2)nc2ccc(-c3cccc(OCCn4cccc4)c3)cc12 |
| InChI | InChI=1S/C26H23N5O/c1-27-26-23-17-20(9-10-24(23)29-25(30-26)21-7-5-11-28-18-21)19-6-4-8-22(16-19)32-15-14-31-12-2-3-13-31/h2-13,16-18H,14-15H2,1H3,(H,27,29,30) |
| InChIKey | ZOYINGNZGWJIKM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |