C20H13FN4OS — CID 67356659
15-fluoro-4-(pyridin-3-ylmethylsulfanyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 67356659) has the molecular formula C20H13FN4OS and a molecular weight of 376.42 g/mol. Its IUPAC name is 15-fluoro-4-(pyridin-3-ylmethylsulfanyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-(pyridin-3-ylmethylsulfanyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 67356659 |
| Molecular Formula | C20H13FN4OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 15-fluoro-4-(pyridin-3-ylmethylsulfanyl)-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=c1[nH]ccc2c3nc(SCc4cccnc4)[nH]c3c3ccc(F)cc3c12 |
| InChI | InChI=1S/C20H13FN4OS/c21-12-3-4-13-15(8-12)16-14(5-7-23-19(16)26)18-17(13)24-20(25-18)27-10-11-2-1-6-22-9-11/h1-9H,10H2,(H,23,26)(H,24,25) |
| InChIKey | UFQNQOKMAHLJOO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|