C14H8FN3O — CID 22574188
15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one (PubChem CID 22574188) has the molecular formula C14H8FN3O and a molecular weight of 253.24 g/mol. Its IUPAC name is 15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 22574188 |
| Molecular Formula | C14H8FN3O |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 15-fluoro-3,5,10-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),4,7(12),8,14,16-heptaen-11-one |
| SMILES | O=c1[nH]ccc2c3nc[nH]c3c3ccc(F)cc3c12 |
| InChI | InChI=1S/C14H8FN3O/c15-7-1-2-8-10(5-7)11-9(3-4-16-14(11)19)13-12(8)17-6-18-13/h1-6H,(H,16,19)(H,17,18) |
| InChIKey | AJUWESXNTKCWFF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|