C20H15FN2O3S — CID 67376167
15-fluoro-4-(1-hydroxy-4-oxocyclohexyl)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one (PubChem CID 67376167) has the molecular formula C20H15FN2O3S and a molecular weight of 382.42 g/mol. Its IUPAC name is 15-fluoro-4-(1-hydroxy-4-oxocyclohexyl)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-(1-hydroxy-4-oxocyclohexyl)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 67376167 |
| Molecular Formula | C20H15FN2O3S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 15-fluoro-4-(1-hydroxy-4-oxocyclohexyl)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
| SMILES | O=C1CCC(O)(c2nc3c4ccc(F)cc4c4c(=O)[nH]ccc4c3s2)CC1 |
| InChI | InChI=1S/C20H15FN2O3S/c21-10-1-2-12-14(9-10)15-13(5-8-22-18(15)25)17-16(12)23-19(27-17)20(26)6-3-11(24)4-7-20/h1-2,5,8-9,26H,3-4,6-7H2,(H,22,25) |
| InChIKey | TXZRCZNUMHNFCU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|