C11H6FNO2 — CID 145414402
8-fluoro-1H-chromeno[4,3-b]pyrrol-4-one (PubChem CID 145414402) has the molecular formula C11H6FNO2 and a molecular weight of 203.17 g/mol. Its IUPAC name is 8-fluoro-1H-chromeno[4,3-b]pyrrol-4-one.
| Compound Name | 8-fluoro-1H-chromeno[4,3-b]pyrrol-4-one |
|---|---|
| PubChem CID | 145414402 |
| Molecular Formula | C11H6FNO2 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 8-fluoro-1H-chromeno[4,3-b]pyrrol-4-one |
| SMILES | O=c1oc2ccc(F)cc2c2[nH]ccc12 |
| InChI | InChI=1S/C11H6FNO2/c12-6-1-2-9-8(5-6)10-7(3-4-13-10)11(14)15-9/h1-5,13H |
| InChIKey | YONVGSMCXLQLQI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|