C14H7F2NO2S — CID 71591586
6-fluoro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one (PubChem CID 71591586) has the molecular formula C14H7F2NO2S and a molecular weight of 291.28 g/mol. Its IUPAC name is 6-fluoro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one.
| Compound Name | 6-fluoro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 71591586 |
| Molecular Formula | C14H7F2NO2S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 6-fluoro-3-(4-fluorophenyl)-4-sulfanylidene-1,3-benzoxazin-2-one |
| SMILES | O=c1oc2ccc(F)cc2c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H7F2NO2S/c15-8-1-4-10(5-2-8)17-13(20)11-7-9(16)3-6-12(11)19-14(17)18/h1-7H |
| InChIKey | QLRQRFXHQBBQCE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|